User:ColorfulGalaxy/Sandbox
This page is a sandbox for the upcoming guide for SMILES.
- Symbols
Name | SMILES | Example name | Example SMILES |
---|---|---|---|
Zero bond | . |
XKCD Oxygen crystal | [O].[O] |
Single bond | - [note 1] |
Ethane | C-C |
Double bond | = |
Ethene | C=C |
Sesqui bond | : |
Benzene (sesqui bond notation) | C1:C:C:C:C:C:1 |
Triple bond | # |
Ethyne | C#C |
Branch group R | (R) |
Isobutane | CC(C)C |
Branch group R via double bond | (=R) |
Acetic acid | CC(=O)O |
Teleport bond | 1 |
Cyclohexane | C1CCCCC1 |
Teleport bond with multiple-digit ID such as "12" | %12 |
tricyclo[2.1.0.01,3]pentane | C1%12CC2%12CC12 |
Aromatic carbon atom | c |
Benzene (lowercase notation) | c1ccccc1 |
Aromatic nitrogen atom | n |
Pyridine (lowercase notation) | n1ccccc1 |
Aromatic oxygen atom | o |
Furan (lowercase notation) | o1cccc1 |
Element "A" with mass number b | [bA] |
Deuterium gas | [2H][2H] |
An "A" ion with positive charge b | [A+b] |
Sodium ion | [Na+1] |
An "A" ion with negative charge b | [A-b] |
Chlorine ion | [Cl-1] |
A D \ / C = C / \ B E[note 2] |
A/C(B)=C(D)/E |
Cis-but-2-ene | [H]/C(C)=C([H])/C |
D B \ / A | E[note 3] |
A[C@](B)(D)E |
L-alanine | N[C@](C)([H])C(=O)O |
- Useful substrings
Name | SMILES |
---|---|
Osazone | C(=NNC1=CC=CC=C1)C(=NNC1=CC=CC=C1)
|
Notes
- ↑ Single bond
-
is often omitted. - ↑ You can also use the
\
character. In this case, Cis-but-2-ene can be represented asC/C=C\C
.
If A is larger than B and D is larger than E, this is called a "Z-" structure. If A is smaller than B and D is larger than E, this is called a "E-" structure. - ↑ This is a top view of the molecule, with the carbon atom obscured under the "A" with a single bond in between.
The structure can also be represented asA[C@@](D)(B)E
.
httpd://conwaylife.com/forums/viewtopic.php?f=12&t=4249&p=144482#p144482 Category:Chemistry